C15H22N6 — CID 130765979
3-(4-benzyl-3,3-dimethylpiperazin-1-yl)-1H-1,2,4-triazol-5-amine (PubChem CID 130765979) has the molecular formula C15H22N6 and a molecular weight of 286.38 g/mol. Its IUPAC name is 3-(4-benzyl-3,3-dimethylpiperazin-1-yl)-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-(4-benzyl-3,3-dimethylpiperazin-1-yl)-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 130765979 |
| Molecular Formula | C15H22N6 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 3-(4-benzyl-3,3-dimethylpiperazin-1-yl)-1H-1,2,4-triazol-5-amine |
| SMILES | CC1(C)CN(c2n[nH]c(N)n2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C15H22N6/c1-15(2)11-20(14-17-13(16)18-19-14)8-9-21(15)10-12-6-4-3-5-7-12/h3-7H,8-11H2,1-2H3,(H3,16,17,18,19) |
| InChIKey | XQJGVVKEZYMCGI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |