C7H6F9O4P — CID 13082389
1-dimethoxyphosphoryl-1,1,2,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propane (PubChem CID 13082389) has the molecular formula C7H6F9O4P and a molecular weight of 356.08 g/mol. Its IUPAC name is 1-dimethoxyphosphoryl-1,1,2,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propane.
| Compound Name | 1-dimethoxyphosphoryl-1,1,2,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propane |
|---|---|
| PubChem CID | 13082389 |
| Molecular Formula | C7H6F9O4P |
| Molecular Weight | 356.08 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | 1-dimethoxyphosphoryl-1,1,2,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propane |
| SMILES | COP(=O)(OC)C(F)(F)C(F)(F)C(F)(F)OC(F)=C(F)F |
| InChI | InChI=1S/C7H6F9O4P/c1-18-21(17,19-2)7(15,16)5(11,12)6(13,14)20-4(10)3(8)9/h1-2H3 |
| InChIKey | ODFHDUZZGVVBFH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.08 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|