C8H9ClN6 — CID 130848412
3-chloro-N-[(1-methyltriazol-4-yl)methyl]pyrazin-2-amine (PubChem CID 130848412) has the molecular formula C8H9ClN6 and a molecular weight of 224.66 g/mol. Its IUPAC name is 3-chloro-N-[(1-methyltriazol-4-yl)methyl]pyrazin-2-amine.
| Compound Name | 3-chloro-N-[(1-methyltriazol-4-yl)methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 130848412 |
| Molecular Formula | C8H9ClN6 |
| Molecular Weight | 224.66 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 3-chloro-N-[(1-methyltriazol-4-yl)methyl]pyrazin-2-amine |
| SMILES | Cn1cc(CNc2nccnc2Cl)nn1 |
| InChI | InChI=1S/C8H9ClN6/c1-15-5-6(13-14-15)4-12-8-7(9)10-2-3-11-8/h2-3,5H,4H2,1H3,(H,11,12) |
| InChIKey | NHDPCRZVSJOAMP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.66 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |