C11H19NO2 — CID 130855783
3,5-dimethyl-4-(oxan-4-yl)pyrrolidin-2-one (PubChem CID 130855783) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 3,5-dimethyl-4-(oxan-4-yl)pyrrolidin-2-one.
| Compound Name | 3,5-dimethyl-4-(oxan-4-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 130855783 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 3,5-dimethyl-4-(oxan-4-yl)pyrrolidin-2-one |
| SMILES | CC1NC(=O)C(C)C1C1CCOCC1 |
| InChI | InChI=1S/C11H19NO2/c1-7-10(8(2)12-11(7)13)9-3-5-14-6-4-9/h7-10H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | ROGMUDZXHDVPDL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |