C10H13IN2 — CID 130865583
6-iodo-N-methyl-1,2,3,4-tetrahydroquinolin-4-amine (PubChem CID 130865583) has the molecular formula C10H13IN2 and a molecular weight of 288.13 g/mol. Its IUPAC name is 6-iodo-N-methyl-1,2,3,4-tetrahydroquinolin-4-amine.
| Compound Name | 6-iodo-N-methyl-1,2,3,4-tetrahydroquinolin-4-amine |
|---|---|
| PubChem CID | 130865583 |
| Molecular Formula | C10H13IN2 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 6-iodo-N-methyl-1,2,3,4-tetrahydroquinolin-4-amine |
| SMILES | CNC1CCNc2ccc(I)cc21 |
| InChI | InChI=1S/C10H13IN2/c1-12-9-4-5-13-10-3-2-7(11)6-8(9)10/h2-3,6,9,12-13H,4-5H2,1H3 |
| InChIKey | NJCDANMGDZRFMZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|