C6H10N4O — CID 130870166
4-amino-1,3,7-triazaspiro[4.4]non-3-en-2-one (PubChem CID 130870166) has the molecular formula C6H10N4O and a molecular weight of 154.17 g/mol. Its IUPAC name is 4-amino-1,3,7-triazaspiro[4.4]non-3-en-2-one.
| Compound Name | 4-amino-1,3,7-triazaspiro[4.4]non-3-en-2-one |
|---|---|
| PubChem CID | 130870166 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 4-amino-1,3,7-triazaspiro[4.4]non-3-en-2-one |
| SMILES | NC1=NC(=O)NC12CCNC2 |
| InChI | InChI=1S/C6H10N4O/c7-4-6(1-2-8-3-6)10-5(11)9-4/h8H,1-3H2,(H3,7,9,10,11) |
| InChIKey | ONBCPDUSJPOAAE-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |