C14H28O4S2 — CID 13087302
2,5-bis(butylsulfinylmethyl)-1,4-dioxane (PubChem CID 13087302) has the molecular formula C14H28O4S2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 2,5-bis(butylsulfinylmethyl)-1,4-dioxane.
| Compound Name | 2,5-bis(butylsulfinylmethyl)-1,4-dioxane |
|---|---|
| PubChem CID | 13087302 |
| Molecular Formula | C14H28O4S2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2,5-bis(butylsulfinylmethyl)-1,4-dioxane |
| SMILES | CCCCS(=O)CC1COC(CS(=O)CCCC)CO1 |
| InChI | InChI=1S/C14H28O4S2/c1-3-5-7-19(15)11-13-9-18-14(10-17-13)12-20(16)8-6-4-2/h13-14H,3-12H2,1-2H3 |
| InChIKey | WDTXZNJFCMZNEA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |