C9H13N3 — CID 130891811
3-[(2S)-azetidin-2-yl]benzene-1,2-diamine (PubChem CID 130891811) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 3-[(2S)-azetidin-2-yl]benzene-1,2-diamine.
| Compound Name | 3-[(2S)-azetidin-2-yl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 130891811 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 3-[(2S)-azetidin-2-yl]benzene-1,2-diamine |
| SMILES | Nc1cccc([C@@H]2CCN2)c1N |
| InChI | InChI=1S/C9H13N3/c10-7-3-1-2-6(9(7)11)8-4-5-12-8/h1-3,8,12H,4-5,10-11H2/t8-/m0/s1 |
| InChIKey | JDKWAKSJKHPGCJ-QMMMGPOBSA-N |
| XLogP | 0.89 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|