C9H14O2 — CID 130905013
cis-(1R,2S)-2-(3-hydroxyprop-1-ynyl)cyclohexan-1-ol (PubChem CID 130905013) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is cis-(1R,2S)-2-(3-hydroxyprop-1-ynyl)cyclohexan-1-ol.
| Compound Name | cis-(1R,2S)-2-(3-hydroxyprop-1-ynyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 130905013 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | cis-(1R,2S)-2-(3-hydroxyprop-1-ynyl)cyclohexan-1-ol |
| SMILES | OCC#C[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C9H14O2/c10-7-3-5-8-4-1-2-6-9(8)11/h8-11H,1-2,4,6-7H2/t8-,9+/m0/s1 |
| InChIKey | YMJOVCMFRMMHAB-DTWKUNHWSA-N |
| XLogP | 0.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|