C8H15F3N2 — CID 130934515
2-methyl-N'-(1,1,1-trifluoro-2-methylpropan-2-yl)propanimidamide (PubChem CID 130934515) has the molecular formula C8H15F3N2 and a molecular weight of 196.22 g/mol. Its IUPAC name is 2-methyl-N'-(1,1,1-trifluoro-2-methylpropan-2-yl)propanimidamide.
| Compound Name | 2-methyl-N'-(1,1,1-trifluoro-2-methylpropan-2-yl)propanimidamide |
|---|---|
| PubChem CID | 130934515 |
| Molecular Formula | C8H15F3N2 |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 2-methyl-N'-(1,1,1-trifluoro-2-methylpropan-2-yl)propanimidamide |
| SMILES | CC(C)/C(N)=N\C(C)(C)C(F)(F)F |
| InChI | InChI=1S/C8H15F3N2/c1-5(2)6(12)13-7(3,4)8(9,10)11/h5H,1-4H3,(H2,12,13) |
| InChIKey | JBIUFVFMSCGBKE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|