C8H15F2N3 — CID 170268144
N-(1-amino-2-methylpropylidene)-3,3-difluorobutanimidamide (PubChem CID 170268144) has the molecular formula C8H15F2N3 and a molecular weight of 191.22 g/mol. Its IUPAC name is N-(1-amino-2-methylpropylidene)-3,3-difluorobutanimidamide.
| Compound Name | N-(1-amino-2-methylpropylidene)-3,3-difluorobutanimidamide |
|---|---|
| PubChem CID | 170268144 |
| Molecular Formula | C8H15F2N3 |
| Molecular Weight | 191.22 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | N-(1-amino-2-methylpropylidene)-3,3-difluorobutanimidamide |
| SMILES | [H]/N=C(CC(C)(F)F)\N=C(\N)C(C)C |
| InChI | InChI=1S/C8H15F2N3/c1-5(2)7(12)13-6(11)4-8(3,9)10/h5H,4H2,1-3H3,(H3,11,12,13) |
| InChIKey | UPOBCISVYMSPTI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|