C10H17ClN2O — CID 130943724
2-chloro-N-[(1,5-dimethylpyrrolidin-3-yl)methyl]prop-2-enamide (PubChem CID 130943724) has the molecular formula C10H17ClN2O and a molecular weight of 216.71 g/mol. Its IUPAC name is 2-chloro-N-[(1,5-dimethylpyrrolidin-3-yl)methyl]prop-2-enamide.
| Compound Name | 2-chloro-N-[(1,5-dimethylpyrrolidin-3-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 130943724 |
| Molecular Formula | C10H17ClN2O |
| Molecular Weight | 216.71 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 2-chloro-N-[(1,5-dimethylpyrrolidin-3-yl)methyl]prop-2-enamide |
| SMILES | C=C(Cl)C(=O)NCC1CC(C)N(C)C1 |
| InChI | InChI=1S/C10H17ClN2O/c1-7-4-9(6-13(7)3)5-12-10(14)8(2)11/h7,9H,2,4-6H2,1,3H3,(H,12,14) |
| InChIKey | DZICYPXZJULYMH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.71 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|