C6H12O3 — CID 130945109
3,3-dimethoxycyclobutan-1-ol (PubChem CID 130945109) has the molecular formula C6H12O3 and a molecular weight of 132.16 g/mol. Its IUPAC name is 3,3-dimethoxycyclobutan-1-ol.
| Compound Name | 3,3-dimethoxycyclobutan-1-ol |
|---|---|
| PubChem CID | 130945109 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | 3,3-dimethoxycyclobutan-1-ol |
| SMILES | COC1(OC)CC(O)C1 |
| InChI | InChI=1S/C6H12O3/c1-8-6(9-2)3-5(7)4-6/h5,7H,3-4H2,1-2H3 |
| InChIKey | SVJAHCCZKKZMMK-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|