About 5-[1-(methylamino)propan-2-yl]-1,2,4-oxadiazol-3-amine
5-[1-(methylamino)propan-2-yl]-1,2,4-oxadiazol-3-amine (PubChem CID 130949129) has the molecular formula C6H12N4O
and a molecular weight of 156.19 g/mol. Its IUPAC name is 5-[1-(methylamino)propan-2-yl]-1,2,4-oxadiazol-3-amine.
Analyze 5-[1-(methylamino)propan-2-yl]-1,2,4-oxadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(methylamino)propan-2-yl]-1,2,4-oxadiazol-3-amine?
The IUPAC name of 5-[1-(methylamino)propan-2-yl]-1,2,4-oxadiazol-3-amine (CID 130949129) is 5-[1-(methylamino)propan-2-yl]-1,2,4-oxadiazol-3-amine.
What is the SMILES notation for 5-[1-(methylamino)propan-2-yl]-1,2,4-oxadiazol-3-amine?
The canonical SMILES for 5-[1-(methylamino)propan-2-yl]-1,2,4-oxadiazol-3-amine is CNCC(C)c1nc(N)no1.
What is the InChIKey of 5-[1-(methylamino)propan-2-yl]-1,2,4-oxadiazol-3-amine?
The InChIKey is INXCQURDOAVTDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4O/c1-4(3-8-2)5-9-6(7)10-11-5/h4,8H,3H2,1-2H3,(H2,7,10).
What are the key properties of 5-[1-(methylamino)propan-2-yl]-1,2,4-oxadiazol-3-amine?
5-[1-(methylamino)propan-2-yl]-1,2,4-oxadiazol-3-amine has a molecular weight of 156.19 g/mol, XLogP of -0.03, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(methylamino)propan-2-yl]-1,2,4-oxadiazol-3-amine is sourced from PubChem (CID 130949129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).