C12H18O — CID 130978550
[(3aS,7aS)-1,2,3,3a,5,6,6a,7-octahydrocyclopenta[a]pentalen-7a-yl]methanol (PubChem CID 130978550) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is [(3aS,7aS)-1,2,3,3a,5,6,6a,7-octahydrocyclopenta[a]pentalen-7a-yl]methanol.
| Compound Name | [(3aS,7aS)-1,2,3,3a,5,6,6a,7-octahydrocyclopenta[a]pentalen-7a-yl]methanol |
|---|---|
| PubChem CID | 130978550 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | [(3aS,7aS)-1,2,3,3a,5,6,6a,7-octahydrocyclopenta[a]pentalen-7a-yl]methanol |
| SMILES | OC[C@]12CCC[C@H]1C1=CCCC1C2 |
| InChI | InChI=1S/C12H18O/c13-8-12-6-2-5-11(12)10-4-1-3-9(10)7-12/h4,9,11,13H,1-3,5-8H2/t9?,11-,12+/m0/s1 |
| InChIKey | QYSAUHPVCGUXCD-CLGJWYQZSA-N |
| XLogP | 2.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|