C9H16O2 — CID 125456485
[(2R,3aR,6aR)-2-methyl-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methanol (PubChem CID 125456485) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is [(2R,3aR,6aR)-2-methyl-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methanol.
| Compound Name | [(2R,3aR,6aR)-2-methyl-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methanol |
|---|---|
| PubChem CID | 125456485 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | [(2R,3aR,6aR)-2-methyl-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methanol |
| SMILES | C[C@@H]1C[C@@]2(CO)CCC[C@H]2O1 |
| InChI | InChI=1S/C9H16O2/c1-7-5-9(6-10)4-2-3-8(9)11-7/h7-8,10H,2-6H2,1H3/t7-,8-,9-/m1/s1 |
| InChIKey | GGRSSSDAPGZOGS-IWSPIJDZSA-N |
| XLogP | 1.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |