C7H11F3N2O3S — CID 131015407
2,2,2-trifluoro-N-(1-methylsulfonylpyrrolidin-3-yl)acetamide (PubChem CID 131015407) has the molecular formula C7H11F3N2O3S and a molecular weight of 260.24 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(1-methylsulfonylpyrrolidin-3-yl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(1-methylsulfonylpyrrolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 131015407 |
| Molecular Formula | C7H11F3N2O3S |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 2,2,2-trifluoro-N-(1-methylsulfonylpyrrolidin-3-yl)acetamide |
| SMILES | CS(=O)(=O)N1CCC(NC(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C7H11F3N2O3S/c1-16(14,15)12-3-2-5(4-12)11-6(13)7(8,9)10/h5H,2-4H2,1H3,(H,11,13) |
| InChIKey | HOVLWFWKVSOGCP-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |