C6H12F2N2O3S — CID 107167631
2,2-difluoro-N-[3-(methanesulfonamido)propyl]acetamide (PubChem CID 107167631) has the molecular formula C6H12F2N2O3S and a molecular weight of 230.24 g/mol. Its IUPAC name is 2,2-difluoro-N-[3-(methanesulfonamido)propyl]acetamide.
| Compound Name | 2,2-difluoro-N-[3-(methanesulfonamido)propyl]acetamide |
|---|---|
| PubChem CID | 107167631 |
| Molecular Formula | C6H12F2N2O3S |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 2,2-difluoro-N-[3-(methanesulfonamido)propyl]acetamide |
| SMILES | CS(=O)(=O)NCCCNC(=O)C(F)F |
| InChI | InChI=1S/C6H12F2N2O3S/c1-14(12,13)10-4-2-3-9-6(11)5(7)8/h5,10H,2-4H2,1H3,(H,9,11) |
| InChIKey | MSAIDIMEPPBADH-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|