C15H14ClNO5S2 — CID 1310161
ethyl [4-[(5-chloro-2,3-dimethoxyphenyl)methylidene]-5-oxo-1,3-thiazol-2-yl]sulfanylformate (PubChem CID 1310161) has the molecular formula C15H14ClNO5S2 and a molecular weight of 387.87 g/mol. Its IUPAC name is ethyl [4-[(5-chloro-2,3-dimethoxyphenyl)methylidene]-5-oxo-1,3-thiazol-2-yl]sulfanylformate.
| Compound Name | ethyl [4-[(5-chloro-2,3-dimethoxyphenyl)methylidene]-5-oxo-1,3-thiazol-2-yl]sulfanylformate |
|---|---|
| PubChem CID | 1310161 |
| Molecular Formula | C15H14ClNO5S2 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | ethyl [4-[(5-chloro-2,3-dimethoxyphenyl)methylidene]-5-oxo-1,3-thiazol-2-yl]sulfanylformate |
| SMILES | CCOC(=O)SC1=NC(=Cc2cc(Cl)cc(OC)c2OC)C(=O)S1 |
| InChI | InChI=1S/C15H14ClNO5S2/c1-4-22-15(19)24-14-17-10(13(18)23-14)6-8-5-9(16)7-11(20-2)12(8)21-3/h5-7H,4H2,1-3H3 |
| InChIKey | LGUNYQUYOMTNAJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|