C18H21NO6 — CID 7257947
ethyl (5Z)-2-methyl-4-oxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-3H-pyrrole-3-carboxylate (PubChem CID 7257947) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is ethyl (5Z)-2-methyl-4-oxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-3H-pyrrole-3-carboxylate.
| Compound Name | ethyl (5Z)-2-methyl-4-oxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-3H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 7257947 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | ethyl (5Z)-2-methyl-4-oxo-5-[(3,4,5-trimethoxyphenyl)methylidene]-3H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)/C(=C/c2cc(OC)c(OC)c(OC)c2)N=C1C |
| InChI | InChI=1S/C18H21NO6/c1-6-25-18(21)15-10(2)19-12(16(15)20)7-11-8-13(22-3)17(24-5)14(9-11)23-4/h7-9,15H,6H2,1-5H3/b12-7- |
| InChIKey | RKHTWQWVCKXWFB-GHXNOFRVSA-N |
| XLogP | 2.28 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|