C8H10F2O2 — CID 131099359
[(1S,2S,3R,4R)-3-(difluoromethyl)-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methanol (PubChem CID 131099359) has the molecular formula C8H10F2O2 and a molecular weight of 176.16 g/mol. Its IUPAC name is [(1S,2S,3R,4R)-3-(difluoromethyl)-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methanol.
| Compound Name | [(1S,2S,3R,4R)-3-(difluoromethyl)-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methanol |
|---|---|
| PubChem CID | 131099359 |
| Molecular Formula | C8H10F2O2 |
| Molecular Weight | 176.16 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | [(1S,2S,3R,4R)-3-(difluoromethyl)-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methanol |
| SMILES | OC[C@@H]1[C@@H](C(F)F)[C@H]2C=C[C@@H]1O2 |
| InChI | InChI=1S/C8H10F2O2/c9-8(10)7-4(3-11)5-1-2-6(7)12-5/h1-2,4-8,11H,3H2/t4-,5-,6+,7+/m0/s1 |
| InChIKey | JYSRVQZOLXAUMU-VWDOSNQTSA-N |
| XLogP | 0.81 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.16 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|