C8H11F2N3S — CID 131137810
[(3,3-difluorocyclobutyl)-(1,2-thiazol-3-yl)methyl]hydrazine (PubChem CID 131137810) has the molecular formula C8H11F2N3S and a molecular weight of 219.26 g/mol. Its IUPAC name is [(3,3-difluorocyclobutyl)-(1,2-thiazol-3-yl)methyl]hydrazine.
| Compound Name | [(3,3-difluorocyclobutyl)-(1,2-thiazol-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 131137810 |
| Molecular Formula | C8H11F2N3S |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | [(3,3-difluorocyclobutyl)-(1,2-thiazol-3-yl)methyl]hydrazine |
| SMILES | NNC(c1ccsn1)C1CC(F)(F)C1 |
| InChI | InChI=1S/C8H11F2N3S/c9-8(10)3-5(4-8)7(12-11)6-1-2-14-13-6/h1-2,5,7,12H,3-4,11H2 |
| InChIKey | XBKXHQRGSATETD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|