C9H16N2S — CID 82406423
4-methyl-1-(1,2-thiazol-3-yl)pentan-1-amine (PubChem CID 82406423) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is 4-methyl-1-(1,2-thiazol-3-yl)pentan-1-amine.
| Compound Name | 4-methyl-1-(1,2-thiazol-3-yl)pentan-1-amine |
|---|---|
| PubChem CID | 82406423 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 4-methyl-1-(1,2-thiazol-3-yl)pentan-1-amine |
| SMILES | CC(C)CCC(N)c1ccsn1 |
| InChI | InChI=1S/C9H16N2S/c1-7(2)3-4-8(10)9-5-6-12-11-9/h5-8H,3-4,10H2,1-2H3 |
| InChIKey | UNVKJGQSAYZFKJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |