C12H9F15 — CID 13116053
3-(difluoromethylidene)-1,1,1,2,2-pentafluoro-4-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)octane (PubChem CID 13116053) has the molecular formula C12H9F15 and a molecular weight of 438.17 g/mol. Its IUPAC name is 3-(difluoromethylidene)-1,1,1,2,2-pentafluoro-4-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)octane.
| Compound Name | 3-(difluoromethylidene)-1,1,1,2,2-pentafluoro-4-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)octane |
|---|---|
| PubChem CID | 13116053 |
| Molecular Formula | C12H9F15 |
| Molecular Weight | 438.17 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | 3-(difluoromethylidene)-1,1,1,2,2-pentafluoro-4-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)octane |
| SMILES | CCCCC(C(=C(F)F)C(F)(F)C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H9F15/c1-2-3-4-7(10(19,20)21,9(17,18)12(25,26)27)5(6(13)14)8(15,16)11(22,23)24/h2-4H2,1H3 |
| InChIKey | PAUSQOIQHLNKFI-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.17 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|