C8H11N3O2S — CID 131165697
N-(2-hydroxycyclopentyl)thiadiazole-4-carboxamide (PubChem CID 131165697) has the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. Its IUPAC name is N-(2-hydroxycyclopentyl)thiadiazole-4-carboxamide.
| Compound Name | N-(2-hydroxycyclopentyl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 131165697 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | N-(2-hydroxycyclopentyl)thiadiazole-4-carboxamide |
| SMILES | O=C(NC1CCCC1O)c1csnn1 |
| InChI | InChI=1S/C8H11N3O2S/c12-7-3-1-2-5(7)9-8(13)6-4-14-11-10-6/h4-5,7,12H,1-3H2,(H,9,13) |
| InChIKey | OMNIBNJGMDINGD-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |