C13H19N — CID 131198085
2,5-dimethyl-1-(1-methylcyclohex-3-en-1-yl)pyrrole (PubChem CID 131198085) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 2,5-dimethyl-1-(1-methylcyclohex-3-en-1-yl)pyrrole.
| Compound Name | 2,5-dimethyl-1-(1-methylcyclohex-3-en-1-yl)pyrrole |
|---|---|
| PubChem CID | 131198085 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 2,5-dimethyl-1-(1-methylcyclohex-3-en-1-yl)pyrrole |
| SMILES | Cc1ccc(C)n1C1(C)CC=CCC1 |
| InChI | InChI=1S/C13H19N/c1-11-7-8-12(2)14(11)13(3)9-5-4-6-10-13/h4-5,7-8H,6,9-10H2,1-3H3 |
| InChIKey | PCGKMOXSQCPNFU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|