C17H12Cl3F3N2O — CID 13121907
1-(2,4,5-trichlorophenyl)-3-[3-(trifluoromethyl)phenyl]-1,3-diazinan-2-one (PubChem CID 13121907) has the molecular formula C17H12Cl3F3N2O and a molecular weight of 423.65 g/mol. Its IUPAC name is 1-(2,4,5-trichlorophenyl)-3-[3-(trifluoromethyl)phenyl]-1,3-diazinan-2-one.
| Compound Name | 1-(2,4,5-trichlorophenyl)-3-[3-(trifluoromethyl)phenyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 13121907 |
| Molecular Formula | C17H12Cl3F3N2O |
| Molecular Weight | 423.65 g/mol |
| Exact Mass | 422.00 |
| IUPAC Name | 1-(2,4,5-trichlorophenyl)-3-[3-(trifluoromethyl)phenyl]-1,3-diazinan-2-one |
| SMILES | O=C1N(c2cccc(C(F)(F)F)c2)CCCN1c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H12Cl3F3N2O/c18-12-8-14(20)15(9-13(12)19)25-6-2-5-24(16(25)26)11-4-1-3-10(7-11)17(21,22)23/h1,3-4,7-9H,2,5-6H2 |
| InChIKey | AYBJXMHVLGTYQZ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.65 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|