C7H13N3S — CID 131227075
1-(1,2-thiazol-5-yl)butylhydrazine (PubChem CID 131227075) has the molecular formula C7H13N3S and a molecular weight of 171.27 g/mol. Its IUPAC name is 1-(1,2-thiazol-5-yl)butylhydrazine.
| Compound Name | 1-(1,2-thiazol-5-yl)butylhydrazine |
|---|---|
| PubChem CID | 131227075 |
| Molecular Formula | C7H13N3S |
| Molecular Weight | 171.27 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 1-(1,2-thiazol-5-yl)butylhydrazine |
| SMILES | CCCC(NN)c1ccns1 |
| InChI | InChI=1S/C7H13N3S/c1-2-3-6(10-8)7-4-5-9-11-7/h4-6,10H,2-3,8H2,1H3 |
| InChIKey | GIRDXBOAUIJHRF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|