C16H12F3N3O4 — CID 1312315
5-[1-(furan-2-ylmethyl)-2-methyl-6-(trifluoromethyl)-4-pyridinylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 1312315) has the molecular formula C16H12F3N3O4 and a molecular weight of 367.28 g/mol. Its IUPAC name is 5-[1-(furan-2-ylmethyl)-2-methyl-6-(trifluoromethyl)-4-pyridinylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[1-(furan-2-ylmethyl)-2-methyl-6-(trifluoromethyl)-4-pyridinylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 1312315 |
| Molecular Formula | C16H12F3N3O4 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 5-[1-(furan-2-ylmethyl)-2-methyl-6-(trifluoromethyl)-4-pyridinylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CC1=CC(=C2C(=O)NC(=O)NC2=O)C=C(C(F)(F)F)N1Cc1ccco1 |
| InChI | InChI=1S/C16H12F3N3O4/c1-8-5-9(12-13(23)20-15(25)21-14(12)24)6-11(16(17,18)19)22(8)7-10-3-2-4-26-10/h2-6H,7H2,1H3,(H2,20,21,23,24,25) |
| InChIKey | CBFIWBZVJPNXQY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|