C9H13ClSi — CID 131236450
[(1E,5E)-6-chlorohexa-1,5-dien-3-ynyl]-trimethylsilane (PubChem CID 131236450) has the molecular formula C9H13ClSi and a molecular weight of 184.74 g/mol. Its IUPAC name is [(1E,5E)-6-chlorohexa-1,5-dien-3-ynyl]-trimethylsilane.
| Compound Name | [(1E,5E)-6-chlorohexa-1,5-dien-3-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 131236450 |
| Molecular Formula | C9H13ClSi |
| Molecular Weight | 184.74 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | [(1E,5E)-6-chlorohexa-1,5-dien-3-ynyl]-trimethylsilane |
| SMILES | C[Si](C)(C)/C=C/C#C/C=C/Cl |
| InChI | InChI=1S/C9H13ClSi/c1-11(2,3)9-7-5-4-6-8-10/h6-9H,1-3H3/b8-6+,9-7+ |
| InChIKey | ZNPZIEWYYGWCMA-CDJQDVQCSA-N |
| XLogP | 3.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.74 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|