C6H9F2NO2 — CID 131243038
(E)-3-(1,1-difluoropropan-2-ylamino)prop-2-enoic acid (PubChem CID 131243038) has the molecular formula C6H9F2NO2 and a molecular weight of 165.14 g/mol. Its IUPAC name is (E)-3-(1,1-difluoropropan-2-ylamino)prop-2-enoic acid.
| Compound Name | (E)-3-(1,1-difluoropropan-2-ylamino)prop-2-enoic acid |
|---|---|
| PubChem CID | 131243038 |
| Molecular Formula | C6H9F2NO2 |
| Molecular Weight | 165.14 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | (E)-3-(1,1-difluoropropan-2-ylamino)prop-2-enoic acid |
| SMILES | CC(N/C=C/C(=O)O)C(F)F |
| InChI | InChI=1S/C6H9F2NO2/c1-4(6(7)8)9-3-2-5(10)11/h2-4,6,9H,1H3,(H,10,11)/b3-2+ |
| InChIKey | HZDZTEPXGYMCQE-NSCUHMNNSA-N |
| XLogP | 0.83 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.14 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|