C15H11N3O4 — CID 13126007
4-hydroxy-7-nitro-5-phenyl-3H-1,4-benzodiazepin-2-one (PubChem CID 13126007) has the molecular formula C15H11N3O4 and a molecular weight of 297.27 g/mol. Its IUPAC name is 4-hydroxy-7-nitro-5-phenyl-3H-1,4-benzodiazepin-2-one.
| Compound Name | 4-hydroxy-7-nitro-5-phenyl-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 13126007 |
| Molecular Formula | C15H11N3O4 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 4-hydroxy-7-nitro-5-phenyl-3H-1,4-benzodiazepin-2-one |
| SMILES | O=C1CN(O)C(c2ccccc2)=c2cc([N+](=O)[O-])ccc2=N1 |
| InChI | InChI=1S/C15H11N3O4/c19-14-9-17(20)15(10-4-2-1-3-5-10)12-8-11(18(21)22)6-7-13(12)16-14/h1-8,20H,9H2 |
| InChIKey | AGNFIHVYYOUKKD-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|