C7H10N2O2 — CID 13130980
1,2,3,4,6,7-hexahydrofuro[2,3-e][1,4]diazepin-5-one (PubChem CID 13130980) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is 1,2,3,4,6,7-hexahydrofuro[2,3-e][1,4]diazepin-5-one.
| Compound Name | 1,2,3,4,6,7-hexahydrofuro[2,3-e][1,4]diazepin-5-one |
|---|---|
| PubChem CID | 13130980 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 1,2,3,4,6,7-hexahydrofuro[2,3-e][1,4]diazepin-5-one |
| SMILES | O=C1NCCNC2=C1CCO2 |
| InChI | InChI=1S/C7H10N2O2/c10-6-5-1-4-11-7(5)9-3-2-8-6/h9H,1-4H2,(H,8,10) |
| InChIKey | XYXAAETUMKFSRI-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |