C9H14N2O2 — CID 13130986
6,7-dimethyl-1,2,3,4,6,7-hexahydrofuro[2,3-e][1,4]diazepin-5-one (PubChem CID 13130986) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 6,7-dimethyl-1,2,3,4,6,7-hexahydrofuro[2,3-e][1,4]diazepin-5-one.
| Compound Name | 6,7-dimethyl-1,2,3,4,6,7-hexahydrofuro[2,3-e][1,4]diazepin-5-one |
|---|---|
| PubChem CID | 13130986 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 6,7-dimethyl-1,2,3,4,6,7-hexahydrofuro[2,3-e][1,4]diazepin-5-one |
| SMILES | CC1OC2=C(C(=O)NCCN2)C1C |
| InChI | InChI=1S/C9H14N2O2/c1-5-6(2)13-9-7(5)8(12)10-3-4-11-9/h5-6,11H,3-4H2,1-2H3,(H,10,12) |
| InChIKey | FPRYDTUVMFPUKZ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |