C8H12N2O2 — CID 13130988
3,5,6,7,8,9-hexahydro-2H-furo[2,3-b][1,5]diazocin-4-one (PubChem CID 13130988) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 3,5,6,7,8,9-hexahydro-2H-furo[2,3-b][1,5]diazocin-4-one.
| Compound Name | 3,5,6,7,8,9-hexahydro-2H-furo[2,3-b][1,5]diazocin-4-one |
|---|---|
| PubChem CID | 13130988 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 3,5,6,7,8,9-hexahydro-2H-furo[2,3-b][1,5]diazocin-4-one |
| SMILES | O=C1NCCCNC2=C1CCO2 |
| InChI | InChI=1S/C8H12N2O2/c11-7-6-2-5-12-8(6)10-4-1-3-9-7/h10H,1-5H2,(H,9,11) |
| InChIKey | QZNSGTHFJFIXPJ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |