C10H10O4S — CID 131313226
ethyl 7-oxo-4H-thieno[3,2-c]pyran-2-carboxylate (PubChem CID 131313226) has the molecular formula C10H10O4S and a molecular weight of 226.25 g/mol. Its IUPAC name is ethyl 7-oxo-4H-thieno[3,2-c]pyran-2-carboxylate.
| Compound Name | ethyl 7-oxo-4H-thieno[3,2-c]pyran-2-carboxylate |
|---|---|
| PubChem CID | 131313226 |
| Molecular Formula | C10H10O4S |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | ethyl 7-oxo-4H-thieno[3,2-c]pyran-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(s1)C(=O)COC2 |
| InChI | InChI=1S/C10H10O4S/c1-2-14-10(12)8-3-6-4-13-5-7(11)9(6)15-8/h3H,2,4-5H2,1H3 |
| InChIKey | DXORLDHURBQZOL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |