C22H24BrO2P — CID 13141489
bromo-(2,2-dimethoxyethyl)-triphenyl-lambda5-phosphane (PubChem CID 13141489) has the molecular formula C22H24BrO2P and a molecular weight of 431.31 g/mol. Its IUPAC name is bromo-(2,2-dimethoxyethyl)-triphenyl-lambda5-phosphane.
| Compound Name | bromo-(2,2-dimethoxyethyl)-triphenyl-lambda5-phosphane |
|---|---|
| PubChem CID | 13141489 |
| Molecular Formula | C22H24BrO2P |
| Molecular Weight | 431.31 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | bromo-(2,2-dimethoxyethyl)-triphenyl-lambda5-phosphane |
| SMILES | COC(CP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1)OC |
| InChI | InChI=1S/C22H24BrO2P/c1-24-22(25-2)18-26(23,19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-17,22H,18H2,1-2H3 |
| InChIKey | HWJDODSTJGOOTK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|