C13H10OS2 — CID 13148574
5-methyl-2,3-dithiophen-2-ylfuran (PubChem CID 13148574) has the molecular formula C13H10OS2 and a molecular weight of 246.36 g/mol. Its IUPAC name is 5-methyl-2,3-dithiophen-2-ylfuran.
| Compound Name | 5-methyl-2,3-dithiophen-2-ylfuran |
|---|---|
| PubChem CID | 13148574 |
| Molecular Formula | C13H10OS2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 5-methyl-2,3-dithiophen-2-ylfuran |
| SMILES | Cc1cc(-c2cccs2)c(-c2cccs2)o1 |
| InChI | InChI=1S/C13H10OS2/c1-9-8-10(11-4-2-6-15-11)13(14-9)12-5-3-7-16-12/h2-8H,1H3 |
| InChIKey | VHLJGQQNGHWEBX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |