About 4-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine
4-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine (PubChem CID 131589354) has the molecular formula C8H9ClN2
and a molecular weight of 168.63 g/mol. Its IUPAC name is 4-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine.
Molecular Properties
| Compound Name | 4-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine |
| PubChem CID | 131589354 |
| Molecular Formula | C8H9ClN2 |
| Molecular Weight | 168.63 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 4-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine |
| SMILES | Nc1cnc2c(c1Cl)CCC2 |
| InChI | InChI=1S/C8H9ClN2/c9-8-5-2-1-3-7(5)11-4-6(8)10/h4H,1-3,10H2 |
| InChIKey | HRXLRASFGRGVTC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.63 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine?
The IUPAC name of 4-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine (CID 131589354) is 4-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine.
What is the SMILES notation for 4-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine?
The canonical SMILES for 4-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine is Nc1cnc2c(c1Cl)CCC2.
What is the InChIKey of 4-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine?
The InChIKey is HRXLRASFGRGVTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClN2/c9-8-5-2-1-3-7(5)11-4-6(8)10/h4H,1-3,10H2.
What are the key properties of 4-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine?
4-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine has a molecular weight of 168.63 g/mol, XLogP of 1.81, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine is sourced from PubChem (CID 131589354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).