C9H10ClN2O- — CID 163970998
4-chloro-N-methyl-N-oxido-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine (PubChem CID 163970998) has the molecular formula C9H10ClN2O- and a molecular weight of 197.65 g/mol. Its IUPAC name is 4-chloro-N-methyl-N-oxido-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine.
| Compound Name | 4-chloro-N-methyl-N-oxido-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine |
|---|---|
| PubChem CID | 163970998 |
| Molecular Formula | C9H10ClN2O- |
| Molecular Weight | 197.65 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 4-chloro-N-methyl-N-oxido-6,7-dihydro-5H-cyclopenta[b]pyridin-3-amine |
| SMILES | CN([O-])c1cnc2c(c1Cl)CCC2 |
| InChI | InChI=1S/C9H10ClN2O/c1-12(13)8-5-11-7-4-2-3-6(7)9(8)10/h5H,2-4H2,1H3/q-1 |
| InChIKey | ONFJAKNGZUUGMX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.65 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|