C19H28N4O2 — CID 13163901
4,4-bis(piperidine-1-carbonyl)heptanedinitrile (PubChem CID 13163901) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 4,4-bis(piperidine-1-carbonyl)heptanedinitrile.
| Compound Name | 4,4-bis(piperidine-1-carbonyl)heptanedinitrile |
|---|---|
| PubChem CID | 13163901 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 4,4-bis(piperidine-1-carbonyl)heptanedinitrile |
| SMILES | N#CCCC(CCC#N)(C(=O)N1CCCCC1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C19H28N4O2/c20-11-7-9-19(10-8-12-21,17(24)22-13-3-1-4-14-22)18(25)23-15-5-2-6-16-23/h1-10,13-16H2 |
| InChIKey | VVUISOMDSOFZKI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 88.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|