C17H20O5-2 — CID 131698778
3-(4-methyl-7-oxooctyl)phthalate (PubChem CID 131698778) has the molecular formula C17H20O5-2 and a molecular weight of 304.34 g/mol. Its IUPAC name is 3-(4-methyl-7-oxooctyl)phthalate.
| Compound Name | 3-(4-methyl-7-oxooctyl)phthalate |
|---|---|
| PubChem CID | 131698778 |
| Molecular Formula | C17H20O5-2 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 3-(4-methyl-7-oxooctyl)phthalate |
| SMILES | CC(=O)CCC(C)CCCc1cccc(C(=O)[O-])c1C(=O)[O-] |
| InChI | InChI=1S/C17H22O5/c1-11(9-10-12(2)18)5-3-6-13-7-4-8-14(16(19)20)15(13)17(21)22/h4,7-8,11H,3,5-6,9-10H2,1-2H3,(H,19,20)(H,21,22)/p-2 |
| InChIKey | TVCWEUOMMJRDSK-UHFFFAOYSA-L |
| XLogP | 0.74 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |