C22H26FN3O8 — CID 131699227
(2S,3S,4S,5R,6R)-6-[2-(ethoxycarbonylamino)-5-(4-fluoro-N-methylanilino)anilino]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 131699227) has the molecular formula C22H26FN3O8 and a molecular weight of 479.46 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-6-[2-(ethoxycarbonylamino)-5-(4-fluoro-N-methylanilino)anilino]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6R)-6-[2-(ethoxycarbonylamino)-5-(4-fluoro-N-methylanilino)anilino]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 131699227 |
| Molecular Formula | C22H26FN3O8 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | (2S,3S,4S,5R,6R)-6-[2-(ethoxycarbonylamino)-5-(4-fluoro-N-methylanilino)anilino]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CCOC(=O)Nc1ccc(N(C)c2ccc(F)cc2)cc1N[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H26FN3O8/c1-3-33-22(32)25-14-9-8-13(26(2)12-6-4-11(23)5-7-12)10-15(14)24-20-18(29)16(27)17(28)19(34-20)21(30)31/h4-10,16-20,24,27-29H,3H2,1-2H3,(H,25,32)(H,30,31)/t16-,17-,18+,19-,20+/m0/s1 |
| InChIKey | QFCIRTMTMBKUCC-UHZRXMQZSA-N |
| XLogP | 1.47 |
| TPSA | 160.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |