About 7-iodoimidazo[1,2-a]pyridin-2-amine
7-iodoimidazo[1,2-a]pyridin-2-amine (PubChem CID 131699714) has the molecular formula C7H6IN3
and a molecular weight of 259.05 g/mol. Its IUPAC name is 7-iodoimidazo[1,2-a]pyridin-2-amine.
Molecular Properties
| Compound Name | 7-iodoimidazo[1,2-a]pyridin-2-amine |
| PubChem CID | 131699714 |
| Molecular Formula | C7H6IN3 |
| Molecular Weight | 259.05 g/mol |
| Exact Mass | 258.96 |
| IUPAC Name | 7-iodoimidazo[1,2-a]pyridin-2-amine |
| SMILES | Nc1cn2ccc(I)cc2n1 |
| InChI | InChI=1S/C7H6IN3/c8-5-1-2-11-4-6(9)10-7(11)3-5/h1-4H,9H2 |
| InChIKey | SXTWMYCLOIMFCA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.05 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-iodoimidazo[1,2-a]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iodoimidazo[1,2-a]pyridin-2-amine?
The IUPAC name of 7-iodoimidazo[1,2-a]pyridin-2-amine (CID 131699714) is 7-iodoimidazo[1,2-a]pyridin-2-amine.
What is the SMILES notation for 7-iodoimidazo[1,2-a]pyridin-2-amine?
The canonical SMILES for 7-iodoimidazo[1,2-a]pyridin-2-amine is Nc1cn2ccc(I)cc2n1.
What is the InChIKey of 7-iodoimidazo[1,2-a]pyridin-2-amine?
The InChIKey is SXTWMYCLOIMFCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6IN3/c8-5-1-2-11-4-6(9)10-7(11)3-5/h1-4H,9H2.
What are the key properties of 7-iodoimidazo[1,2-a]pyridin-2-amine?
7-iodoimidazo[1,2-a]pyridin-2-amine has a molecular weight of 259.05 g/mol, XLogP of 1.52, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iodoimidazo[1,2-a]pyridin-2-amine is sourced from PubChem (CID 131699714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).