C9H14ClPd+ — CID 131700193
carbanide;(1E,5Z)-1-chlorocycloocta-1,5-diene;palladium(2+) (PubChem CID 131700193) has the molecular formula C9H14ClPd+ and a molecular weight of 264.08 g/mol. Its IUPAC name is carbanide;(1E,5Z)-1-chlorocycloocta-1,5-diene;palladium(2+).
| Compound Name | carbanide;(1E,5Z)-1-chlorocycloocta-1,5-diene;palladium(2+) |
|---|---|
| PubChem CID | 131700193 |
| Molecular Formula | C9H14ClPd+ |
| Molecular Weight | 264.08 g/mol |
| Exact Mass | 262.98 |
| IUPAC Name | carbanide;(1E,5Z)-1-chlorocycloocta-1,5-diene;palladium(2+) |
| SMILES | Cl/C1=C/CC/C=C\CC1.[CH3-].[Pd+2] |
| InChI | InChI=1S/C8H11Cl.CH3.Pd/c9-8-6-4-2-1-3-5-7-8;;/h1-2,7H,3-6H2;1H3;/q;-1;+2/b2-1-,8-7+;; |
| InChIKey | KCPSSRNPZIQNDQ-LXWICEPUSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.08 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|