C17H22N2O — CID 13170197
3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-pentylbenzonitrile (PubChem CID 13170197) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-pentylbenzonitrile.
| Compound Name | 3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-pentylbenzonitrile |
|---|---|
| PubChem CID | 13170197 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-pentylbenzonitrile |
| SMILES | CCCCCc1c(C#N)cccc1C1=NC(C)(C)CO1 |
| InChI | InChI=1S/C17H22N2O/c1-4-5-6-9-14-13(11-18)8-7-10-15(14)16-19-17(2,3)12-20-16/h7-8,10H,4-6,9,12H2,1-3H3 |
| InChIKey | XQCKLWWHPGBORD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|