C18H28NO4- — CID 131708342
(2S,3S)-3-methyl-2-[[2-[(1R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]pentanoate (PubChem CID 131708342) has the molecular formula C18H28NO4- and a molecular weight of 322.43 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-[[2-[(1R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]pentanoate.
| Compound Name | (2S,3S)-3-methyl-2-[[2-[(1R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]pentanoate |
|---|---|
| PubChem CID | 131708342 |
| Molecular Formula | C18H28NO4- |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (2S,3S)-3-methyl-2-[[2-[(1R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]pentanoate |
| SMILES | CC/C=C\CC1C(=O)CC[C@@H]1CC(=O)N[C@H](C(=O)[O-])[C@@H](C)CC |
| InChI | InChI=1S/C18H29NO4/c1-4-6-7-8-14-13(9-10-15(14)20)11-16(21)19-17(18(22)23)12(3)5-2/h6-7,12-14,17H,4-5,8-11H2,1-3H3,(H,19,21)(H,22,23)/p-1/b7-6-/t12-,13+,14?,17-/m0/s1 |
| InChIKey | IBZYPBGPOGJMBF-LVJZJYDISA-M |
| XLogP | 1.61 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|