C29H28ClN5O3S — CID 131714817
N-[14-[2-(diethylamino)ethyl]-8-thia-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-10-yl]-2-(1,3-dioxoisoindol-2-yl)acetamide;hydrochloride (PubChem CID 131714817) has the molecular formula C29H28ClN5O3S and a molecular weight of 562.10 g/mol. Its IUPAC name is N-[14-[2-(diethylamino)ethyl]-8-thia-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-10-yl]-2-(1,3-dioxoisoindol-2-yl)acetamide;hydrochloride.
| Compound Name | N-[14-[2-(diethylamino)ethyl]-8-thia-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-10-yl]-2-(1,3-dioxoisoindol-2-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 131714817 |
| Molecular Formula | C29H28ClN5O3S |
| Molecular Weight | 562.10 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | N-[14-[2-(diethylamino)ethyl]-8-thia-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-10-yl]-2-(1,3-dioxoisoindol-2-yl)acetamide;hydrochloride |
| SMILES | CCN(CC)CCn1nc2c3c(c(NC(=O)CN4C(=O)c5ccccc5C4=O)ccc31)Sc1ccccc1-2.Cl |
| InChI | InChI=1S/C29H27N5O3S.ClH/c1-3-32(4-2)15-16-34-22-14-13-21(27-25(22)26(31-34)20-11-7-8-12-23(20)38-27)30-24(35)17-33-28(36)18-9-5-6-10-19(18)29(33)37;/h5-14H,3-4,15-17H2,1-2H3,(H,30,35);1H |
| InChIKey | FYEITUNAJKIBQT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.10 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|