C40H39N5OS — CID 14872078
N-[14-[2-(diethylamino)ethyl]-8-thia-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-10-yl]-2-(tritylamino)acetamide (PubChem CID 14872078) has the molecular formula C40H39N5OS and a molecular weight of 637.85 g/mol. Its IUPAC name is N-[14-[2-(diethylamino)ethyl]-8-thia-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-10-yl]-2-(tritylamino)acetamide.
| Compound Name | N-[14-[2-(diethylamino)ethyl]-8-thia-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-10-yl]-2-(tritylamino)acetamide |
|---|---|
| PubChem CID | 14872078 |
| Molecular Formula | C40H39N5OS |
| Molecular Weight | 637.85 g/mol |
| Exact Mass | 637.29 |
| IUPAC Name | N-[14-[2-(diethylamino)ethyl]-8-thia-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-10-yl]-2-(tritylamino)acetamide |
| SMILES | CCN(CC)CCn1nc2c3c(c(NC(=O)CNC(c4ccccc4)(c4ccccc4)c4ccccc4)ccc31)Sc1ccccc1-2 |
| InChI | InChI=1S/C40H39N5OS/c1-3-44(4-2)26-27-45-34-25-24-33(39-37(34)38(43-45)32-22-14-15-23-35(32)47-39)42-36(46)28-41-40(29-16-8-5-9-17-29,30-18-10-6-11-19-30)31-20-12-7-13-21-31/h5-25,41H,3-4,26-28H2,1-2H3,(H,42,46) |
| InChIKey | OXZNPJHKDBAAMX-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.85 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|