C30H31N5O3S — CID 14406774
2-[2-[[14-[2-(diethylamino)ethyl]-5-methoxy-8-thia-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-yl]amino]ethyl]isoindole-1,3-dione (PubChem CID 14406774) has the molecular formula C30H31N5O3S and a molecular weight of 541.68 g/mol. Its IUPAC name is 2-[2-[[14-[2-(diethylamino)ethyl]-5-methoxy-8-thia-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-yl]amino]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[[14-[2-(diethylamino)ethyl]-5-methoxy-8-thia-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-yl]amino]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 14406774 |
| Molecular Formula | C30H31N5O3S |
| Molecular Weight | 541.68 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | 2-[2-[[14-[2-(diethylamino)ethyl]-5-methoxy-8-thia-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-10-yl]amino]ethyl]isoindole-1,3-dione |
| SMILES | CCN(CC)CCn1nc2c3c(c(NCCN4C(=O)c5ccccc5C4=O)ccc31)Sc1cc(OC)ccc1-2 |
| InChI | InChI=1S/C30H31N5O3S/c1-4-33(5-2)16-17-35-24-13-12-23(31-14-15-34-29(36)20-8-6-7-9-21(20)30(34)37)28-26(24)27(32-35)22-11-10-19(38-3)18-25(22)39-28/h6-13,18,31H,4-5,14-17H2,1-3H3 |
| InChIKey | IMBLGGYIZSYMTJ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.68 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|